Job #157 - Mercaptopurine_melatonin_asiprin
Created at: Last updated at: Current status:
Overall Progress
|
|
Ligand Models 1
| Name | asiprin |
| 2D and 3D depictions |
|
| SMILES | CC(=O)Oc1ccccc1C(=O)O |
| Model downloads | |
| Fingerprints | |
Ligand Models 2
| Name | Mercaptopurine |
| 2D and 3D depictions |
|
| SMILES | S=c1nc[nH]c2nc[nH]c12 |
| Model downloads | |
| Fingerprints | |
Ligand Models 3
| Name | melatonin |
| 2D and 3D depictions |
|
| SMILES | COc2ccc1[nH]cc(CCNC(C)=O)c1c2 |
| Model downloads | |
| Fingerprints | |