On Target MC5R_HUMAN 0/CHEMBL390130
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL390130. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL390130 (Similar Ligand) |
|---|---|
| C | NCC(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)N2CCN(CC2)c3ccccc3CNCCc4cccs4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0001c002 00003200 00100120 04010600 00000000 00100040 00000080 2200100c 00000880 20480ac0 08300204 c000b880 0600a836 00002001 02022440 00044000 00240000 0300000a 08004008 00800205 40100900 78288780 20000023 8340001a 02002800 c4000000 00040000 90001084 0c008100 0006000b 30044000 40c30600 |