On Target CXCR2_HUMAN 0/CHEMBL213147
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL213147. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL213147 (Similar Ligand) |
|---|---|
| C | CN(C)C(=O)c1cccc(\N=C/2\C(\C(=C2O)O)=N\[C@@H]3CCc4ccccc34)c1O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1082001a 01000a88 28200103 14010620 00a00000 00030082 12000010 32021500 08900c00 201808c3 08330004 60008000 c0088802 40203080 001000c8 100a6088 20014c00 02000000 00400020 00020041 c0004101 38028601 21004202 0240081c 080c0200 a8120000 40400480 a0400801 09694110 2006002b 84040000 04100600 |