On Target 5HT1A_HUMAN 0/CHEMBL1277006
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1277006. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1277006 (Similar Ligand) |
|---|---|
| C | O=C1NC(=NC2=C1CCCC2)CCCCN3CCN(CC3)c4ccc5ccccc5n4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000400a 01002800 00104122 54840610 04040522 00004000 01003800 20000409 06400900 20080af0 20308004 40818800 08008882 0270a800 00020040 001c0004 00048200 0600c000 08602008 40a00201 44300400 3e008008 20804861 82300112 00042000 80000201 200000a0 10041080 0808c01e 06c60802 40241080 600002a0 |