On Target HRH1_HUMAN 0/CHEMBL1276947
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1276947. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1276947 (Similar Ligand) |
|---|---|
| C | OC(=O)[C@]12C[C@H]1CN(C2)C3CC[C@@]4(C3)Cc5ccccc5Cc6ccccc46 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 01000200 00100102 00010600 00180000 00000012 00000400 21000001 04100800 000808c0 08300000 50019000 0c008012 01200000 00000020 020c0008 00000000 02000000 00d02010 00000201 00000100 18100a10 01404080 00500810 00001001 a0000001 00000000 50000000 02000082 0106000a 00020000 00802f00 |