On Target BKRB2_HUMAN 0/CHEMBL133913
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL133913. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL133913 (Similar Ligand) |
|---|---|
| C | CNC(=O)c1ccc(\C=C\C(=O)NCC(=O)N(C)c2ccc(C)c(COc3cccc4ncc(C)nc34)c2C)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04004002 0000a808 60000128 54010610 04041061 04004044 86908080 02421408 11800100 00400a50 00280804 4004a800 82808802 0871a000 01860043 020c000c 28240400 02000104 08218000 80861000 41100000 28028620 21802000 02c0900e 00040400 80082000 0848a210 c0011084 08428305 00060801 e4044000 00200200 |