On Target CXCR4_HUMAN 0/CHEMBL374108
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL374108. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL374108 (Similar Ligand) |
|---|---|
| C | C[C@@H]1NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc2ccc3ccccc3c2)NC(=O)CNC(=O)[C@@H](Cc4ccc(O)cc4)NC1=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01003208 20100100 04010e00 00000000 00000000 02000000 2000200c 00200a80 000808c2 08300000 4003b000 06009012 00002001 80000000 00140008 00000000 02000000 00000008 00020201 00000100 38250628 00000003 83500018 00000800 80000000 40120000 10000000 0c000010 0006000b a0084000 00002600 |