On Target GRM2_HUMAN 0/CHEMBL323541
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL323541. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL323541 (Similar Ligand) |
|---|---|
| C | CCOC(=O)C(C)(C)Oc1cccc(c1)N(Cc2cccnc2)S(=O)(=O)CC(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 14004002 84008008 2018450a 01310610 80041000 05000000 02004001 02001040 00002080 20001840 01342404 4000d000 00808c02 08040001 89280041 000e020c 00060080 82100004 08200002 10026c00 401000a0 08008a00 25810000 08400030 02040480 00004000 c8000008 908008ac 00408308 00060000 00000000 88030360 |