On Target NPY1R_HUMAN 0/CHEMBL412378
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL412378. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL412378 (Similar Ligand) |
|---|---|
| C | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc2ccc(cc2)c3ccccc3)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc4ccc(O)cc4)C(=O)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04032002 01007608 20100100 05810e10 040002c2 00000000 02012020 2000000c 00600980 000b0bc2 28308010 5003b800 1e008012 00102809 811a0000 000c000c 10020800 0e000001 04800018 50020201 20000d00 382c0620 33000083 93500018 00041801 80000200 40130000 10000140 0c004006 0046001b 60004000 20802600 |