On Target NPFF1_HUMAN 0/CHEMBL1672380
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1672380. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1672380 (Similar Ligand) |
|---|---|
| C | NC(=N)NCCC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](Cc4ccccc4)C(=O)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01003200 00100100 04010e00 00000000 00000000 00000000 2000200c 00200a80 000808c2 08300000 4003b000 0600901a 00002001 80000000 00100000 00000000 02000000 02002008 00000201 00000100 38250630 00000003 83500018 00000800 80000000 40000000 10000000 0c000010 0006000b a00a4000 00002600 |