On Target ADRB1_HUMAN 0/CHEMBL251347
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL251347. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL251347 (Similar Ligand) |
|---|---|
| C | COc1ccc(cc1)[C@H](CCc2ccccc2)NC[C@H](O)Cc3ccc(O)c(NS(=O)(=O)C)c3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000000a 01000208 2010010a 00310600 000010c0 00000000 02040000 22001000 00400800 000808c0 08302004 40008000 00000c02 00200801 810c1441 000e4028 18080000 0a000000 00000000 00024201 40000100 18008800 23000000 00400010 00040080 c0000000 00320000 9000000c 00400302 0006000a 20040000 00012660 |