On Target GRM3_HUMAN 0/CHEMBL90675
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL90675. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL90675 (Similar Ligand) |
|---|---|
| C | N[C@@H]([C@H]1[C@@H](CCC2c3ccccc3Oc4ccccc24)[C@@H]1C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 01000008 2000010a 00018600 00181000 00000000 02000000 01000200 00000804 000a08c0 08100000 4001b040 0400803a 03a00000 01000001 00082008 00000000 02000000 00402000 00020001 00400100 18000a10 03000000 06400410 00000000 e0000000 00000000 40200000 00000382 00064002 02020400 00000400 |