On Target MSHR_HUMAN 0/CHEMBL385000
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL385000. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL385000 (Similar Ligand) |
|---|---|
| C | CNC(=O)[C@H](Cc1ccc2ccccc2c1)N3CCN([C@@H](CCCN=C(N)N)C3=O)C(=O)[C@@H](Cc4ccc(F)cc4)NC(=O)[C@H](Cc5ccc(O)cc5)NC(=O)C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01003208 20100100 06010e00 00000002 00000010 02010000 2000000c 00200880 000808c2 08300010 4003b000 06008012 00003009 80000000 00040008 00000800 02000080 00000008 00120201 00000100 38240628 00000023 83500018 00000800 80000000 40130000 10000001 0c000000 0006800b 20004000 00002600 |