On Target CXCR3_HUMAN 0/CHEMBL1077810
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1077810. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1077810 (Similar Ligand) |
|---|---|
| C | CCOc1ccc(cc1)N2C(=O)c3ccccc3N=C2[C@@H](C)N(Cc4cccnc4)C(=O)Cc5ccc(cn5)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1400000a 01808208 20104128 10000e10 000c1060 00104020 0200dc02 02003009 06100180 40080af0 0921800c 40819800 01809882 02600200 410604c1 020c010c 08020028 0a008006 00600000 00020a01 c0000081 18218e38 21800041 81700418 00141002 c00800c0 28048140 90040000 04404304 0046000b 60747000 e1106680 |