On Target AA1R_HUMAN 0/CHEMBL1257702
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1257702. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1257702 (Similar Ligand) |
|---|---|
| C | COc1ccc(Nc2c(c(C)nn2c3ccccc3C)c4ccc(cc4)C(=O)C)c(c1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000007 48000a09 22000188 50010610 21081020 0001400a 42800010 00081048 00802104 104908d0 89308104 42009810 04008822 00380000 21034845 a20c604c 00060240 82c02000 0c49811a 10221200 41080040 18038a20 21800800 83400114 80040001 81000000 26170000 000018c0 0400c38c 1066000b c0060800 800004e0 |