On Target CCR1_HUMAN 0/CHEMBL68692
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL68692. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL68692 (Similar Ligand) |
|---|---|
| C | CC(C)(F)CCC(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)c2cnc3ccccc3n2)C(=O)N4CCCC4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1005001a 01805000 00100902 10010e10 001c1ce0 00100010 0000c000 20003005 10000880 000808c0 09390004 40019000 0400881a 00f00000 00860440 020c010c 18020000 02000002 00602000 00000201 c0000100 18258e30 23806040 81500018 00140000 80000000 08008020 90000004 04000006 02060803 a0060000 80006e00 |