On Target GASR_HUMAN 0/CHEMBL92586
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL92586. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL92586 (Similar Ligand) |
|---|---|
| C | COc1cccc(c1)N(C(C)C)C(=O)CN2C(=O)C(Cc3n[nH]c4ccccc34)C(=O)N(c5ccccc5)c6ccccc26 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004002 80002608 20100129 04010600 31041000 00002002 02000030 20300208 00002900 000c0be0 0838a004 7000b040 0e008002 08502000 81060041 0004200c 00240080 16004000 0860001a 10222641 60100100 3c000608 24802801 0260001a 00103800 80000080 02120020 10008180 08008204 0206801b 20005000 00024620 |