On Target AA2BR_HUMAN 0/CHEMBL258535
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL258535. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL258535 (Similar Ligand) |
|---|---|
| C | CCNc1nc(nc2c1ncn2[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C#C[C@@H](O)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0001020a 01c89808 80080508 980916a0 0178a0e0 0000c000 00009c00 00020800 10400100 018808f1 0c20a00c 4001980c 04001000 03980101 100a1081 181fe00c 00240028 02004000 19c00002 80201001 80180020 18042070 27804044 0c400414 10200402 c0100002 40008600 100000f0 0002020d 00660842 c0281804 080086c8 |