On Target 5HT4R_HUMAN 0.27480915/CHEMBL555447
For the given ligand ttt, we have found in our database that, being scored 0.27480915, the most similar ligand is CHEMBL555447. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL555447 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | COc1cc(N)c(Cl)cc1C(=O)NC2CCN(CCCCCCCCO)CC2 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00008002 89001c08 20100108 80010600 00081000 00020100 06000000 22001400 00000000 001009e8 08200004 50018800 02008806 08800000 81000441 00082008 00000000 02000400 00402000 00020601 40000000 180a8710 21000000 0050001c 00002000 c0000400 00100800 90000000 00000300 00060811 a4060000 00022200 |