On Target OPRX_HUMAN 0.40350878/CHEMBL506634
For the given ligand ttt, we have found in our database that, being scored 0.40350878, the most similar ligand is CHEMBL506634. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL506634 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | Cc1ccc(C(N2C3CCC2CC(O)(C3)C4CCNC4=O)c5ccccc5Cl)c(Cl)c1 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00038000 01001000 00100100 00010600 00180000 00000010 04000000 23001000 00000100 800808c0 08200000 50019800 9600881e 00800000 80000400 00080008 00000000 02000000 00c02000 00000201 00000c00 18048730 01000080 00500018 00002001 e0000200 00000000 d0001180 00000180 00060003 2c060000 00022e00 |