On Target CXCR4_HUMAN 0.28030303/CHEMBL366033
For the given ligand ttt, we have found in our database that, being scored 0.28030303, the most similar ligand is CHEMBL366033. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL366033 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | NC(=N)NCCC[C@@H]1NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)CNC(=O)[C@H](Cc3ccc4ccccc4c3)NC1=O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 01003208 20100100 04010e00 00180000 00000000 02000000 2000200c 00200a80 000a08c2 08300000 4003b000 06009032 01002001 80000000 001c0008 00000000 02000000 00400008 00020201 00000100 38250e28 01000003 83500018 00000800 80000000 40120000 10000000 0c000010 0006000b a0084000 00802e00 |