On Target 5HT1B_HUMAN 0.28448275/CHEMBL2205816
For the given ligand ttt, we have found in our database that, being scored 0.28448275, the most similar ligand is CHEMBL2205816. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL2205816 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | OC12C3C4CC5C6C4C1C6C(C35)N2CCc7ccccn7 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 0400000a 01000000 00104120 10000600 001c0020 00008010 00000000 20000000 00c00280 000802c0 08208004 40810000 00000802 00800010 01020000 021c000c 00000000 0a000000 02602000 80000201 40000000 18208050 21800000 81500010 00001000 80000000 00000040 10001000 04000004 01060002 80020000 20002e00 |