On Target GRM1_HUMAN 0.3857143/CHEMBL38499
For the given ligand ttt, we have found in our database that, being scored 0.3857143, the most similar ligand is CHEMBL38499. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL38499 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | N[C@@H](CC(=C)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 81000000 00000000 00000400 00180000 00000000 00080000 00000400 01000000 00120080 00000000 40003000 04008020 02000000 00000000 00080008 00000000 00000000 00400010 00000001 00000000 10000a00 03000000 00000010 00000000 00000000 00000000 80000000 00000000 80040000 04000000 00000000 |