On Target ACM3_HUMAN 0.44705883/CHEMBL480464
For the given ligand ttt, we have found in our database that, being scored 0.44705883, the most similar ligand is CHEMBL480464. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL480464 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC[C@@H](C)[C@@H](O)C(=O)OC[C@H]1CCN2CCC[C@@H]12 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00010040 01000000 00100100 00010700 00180000 00000010 00000000 20000000 00000000 00000080 00200000 4001d000 04008002 00880000 00000000 00089008 00a20000 00000000 00c02000 00000201 00000020 10000a10 05000080 08100010 00000401 00000000 00000200 10000020 00000200 00040006 00020000 00002a00 |