On Target CXCR3_HUMAN 0.33898306/CHEMBL3697091
For the given ligand ttt, we have found in our database that, being scored 0.33898306, the most similar ligand is CHEMBL3697091. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL3697091 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | C[C@H](N(C[C@@H]1CC[C@H](CC1)C(=O)O)Cc2ccc(CCCN3C(=O)CCC3=O)c(C)c2)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00038000 01001200 00100100 00010600 00080001 00000010 10000000 22001000 00000900 000808c0 08300000 40019800 8600886e 00a00000 00000400 020c0008 00002000 02000000 02402000 00000201 00020100 18048f10 01004000 00500018 00002000 c0000001 08040000 90000000 00000102 0006000b 20060000 00822600 |