On Target NK1R_HUMAN 0.36301368/CHEMBL202568
For the given ligand ttt, we have found in our database that, being scored 0.36301368, the most similar ligand is CHEMBL202568. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL202568 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | OC(=O)C1CC2(NC1CCC2NCc3cc(OC(F)(F)F)ccc3OC4CC4)c5ccc(F)cc5 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 04030000 45000008 2010010a 06010600 00191010 02000110 02000000 22001400 00300880 001908c0 08300000 50439000 0c80881a 01a03000 01000401 00082008 00000000 22008180 00c82010 00120201 00000140 38208a30 01000089 83548010 00001001 c0000000 00080000 d0001001 0e000302 00068002 24060000 02c02e00 |