On Target HRH3_HUMAN 0.475/CHEMBL488209
For the given ligand ttt, we have found in our database that, being scored 0.475, the most similar ligand is CHEMBL488209. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL488209 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CN[C@H]1CC[C@]2(C)[C@H]3CC[C@]45CN(C)C(=O)[C@H]4CC[C@H]5[C@@H]3CC=C2C1 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 09001000 00100000 00000400 00000000 00000010 00080000 20000402 00000000 00100080 00200000 41011000 0402800a 00000000 00000400 00000000 00000000 00000060 02012000 00000201 00000000 10040610 00008000 00100018 00200000 00000000 00404000 90000000 00000000 01040401 24020000 00802200 |