On Target CCR5_HUMAN 0.35514018/CHEMBL322603
For the given ligand ttt, we have found in our database that, being scored 0.35514018, the most similar ligand is CHEMBL322603. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL322603 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | OC(=O)[C@@H](C1CCCCC1)N2C[C@H](CN3CCC(O)(CCCc4ccccc4)CC3)[C@H](C2)c5ccccc5 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00010000 01000600 00100102 00010600 00080080 00000010 00000000 20000000 00200880 000809e0 08300000 5003b000 0600800a 00a00000 80080000 000c0008 10000000 02000000 02c02000 00000201 00000100 18200a10 03000080 81500010 00000001 80000000 00000000 10000000 04000002 0006001a 00024000 00002600 |