On Target VIPR1_HUMAN 0.060240965/CHEMBL483749
For the given ligand ZJH-P, we have found in our database that, being scored 0.060240965, the most similar ligand is CHEMBL483749. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL483749 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | O=C(NN1CCCCC1)c2ccc3Sc4ccccc4C(=Nc3c2)C5CCCCC5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000006 09841a80 00120902 08110e20 00040007 00000022 10000010 00007002 02900900 000808c9 0831002c 70018810 0a008802 40218000 200000c0 10080004 04001810 02000005 06202010 00020201 c0000101 1a0b8600 61804002 0048881d 000c7200 88100000 40000410 18000000 0148020a 014f0002 c0060100 001506a8 |