On Target GRM4_HUMAN 0.15853658/CHEMBL578988
For the given ligand ZJH-P, we have found in our database that, being scored 0.15853658, the most similar ligand is CHEMBL578988. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL578988 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC(=O)[C@@H]1CCCC[C@@H]1C(=O)Nc2cc(Cl)cc(Cl)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 0007c002 01000000 00100000 01000600 20180000 00002020 08000000 00000000 00000000 000008c0 00280004 40019800 0600800c 00900401 00020040 00080008 00040000 00000000 0a402000 00004001 40100000 18000f10 21002000 00100010 00002000 00000000 00000000 10000080 00008002 00060001 00020000 00820a00 |