On Target HRH4_HUMAN 0.15789473/CHEMBL1824228
For the given ligand ZJH-P, we have found in our database that, being scored 0.15789473, the most similar ligand is CHEMBL1824228. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1824228 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | C(C1CCCCC1)c2c[nH]cn2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000002 01000000 00000002 00800010 04000140 00000000 01002000 00000000 00400900 00080000 20008000 40000800 00000000 00100800 00020000 000c0004 00000000 06000000 02002008 40000001 00100400 00000000 21000000 00000010 00040000 00000200 00000000 00000080 00000006 00420000 40020000 20000000 |