On Target TSHR_HUMAN 0.11570248/CHEMBL3945037
For the given ligand ZJH-P, we have found in our database that, being scored 0.11570248, the most similar ligand is CHEMBL3945037. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL3945037 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | CC(=O)N1CCC(C)(c2ccccc2)c3cc(NC(=O)O[C@H]4CC5CC[C@H]4C5)ccc13 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 08004002 01401200 00100100 00010700 24084020 00082040 00000000 a1000000 00400a04 000808d0 08380024 40008000 00008002 00900900 00020040 001c0008 00868000 02800001 0a402808 00400201 44100100 18040e10 21002002 00400018 00040000 a1001002 00000010 50001080 00488280 8106000b 00020080 20000600 |