On Target DRD4_HUMAN 0.18032786/CHEMBL162762
For the given ligand ZJH-P, we have found in our database that, being scored 0.18032786, the most similar ligand is CHEMBL162762. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL162762 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | CCCN(CCC)C1CCC(=CC1)C#C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 08000000 09000000 00100000 00000400 00412000 00000000 00080000 20000402 10000000 00100088 00200080 41010000 00020002 00000000 00000400 10000000 00004000 00000060 00002000 00000201 00000008 10000000 00008000 00102010 00000000 00000000 00404000 92800000 04000000 00040600 04020800 00002200 |