On Target MSHR_HUMAN 0.11764706/CHEMBL339053
For the given ligand ZJH-P, we have found in our database that, being scored 0.11764706, the most similar ligand is CHEMBL339053. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL339053 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | Clc1ccc(C[C@@H](NC(=O)[C@H]2Cc3ccccc3CN2)C(=O)N4CCC(Cn5cncn5)(CC4)C6CCCCC6)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 0000800c 01003208 40100100 14010600 00080020 00008004 01000000 2200100c 00200980 000908c0 08300008 5003b800 06008826 01a02001 80000480 020c000c 00008000 02000020 02402008 00200201 80020100 38248750 21004003 83500018 00002800 c0000001 00044100 90000000 0c000100 0086000b a0064000 00022700 |