On Target CCR1_HUMAN 0.16/CHEMBL3138187
For the given ligand ZJH-P, we have found in our database that, being scored 0.16, the most similar ligand is CHEMBL3138187. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL3138187 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(c5)C(=O)O)c6cc(Cl)c(O)c(c6)C(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00008000 15000808 20000300 00010200 00000001 00024000 86200280 01000c00 00000100 00180a44 28000000 40008a00 02028006 00000000 80000402 08082008 00000400 02000000 02002000 40020001 00000000 08020b20 00008021 00400014 01002000 a0000800 00526000 c0000000 00404080 01220b02 e4020000 00020400 |