On Target MC4R_HUMAN 0.19402985/CHEMBL1519347
For the given ligand ZJH-P, we have found in our database that, being scored 0.19402985, the most similar ligand is CHEMBL1519347. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1519347 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | O=C(Nc1ccccc1)OC2CCC3CC2CCC3OC(=O)Nc4ccccc4 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000002 01400000 00000100 00010300 00080000 00000000 00000000 80000000 00000204 00000840 00280004 40008000 00008000 02900100 00000040 00180008 00868000 00800000 0a402800 00400001 40000000 08000c10 21002002 00000010 00000000 00001002 00000000 00000080 00008200 80060003 00020000 00000000 |