On Target NPSR1_HUMAN 0.09756097/CHEMBL1801330
For the given ligand ZJH-P, we have found in our database that, being scored 0.09756097, the most similar ligand is CHEMBL1801330. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1801330 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | N#Cc1ccc(cc1)C2(CC3CCCCC3)c4ccccc4c5nccn25 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00004102 01800200 00100102 10010600 20080060 00002000 00000400 01081000 80000900 108818c0 08108008 40818800 81001800 00a00000 008200a0 020d0004 00400000 0e002000 02c82000 00400001 80100100 38008010 21005440 81500011 00000000 e0000001 00000000 50014080 06000086 00460c0a 400e0800 00000400 |