On Target HRH2_HUMAN 0.17721519/CHEMBL2205812
For the given ligand ZJH-P, we have found in our database that, being scored 0.17721519, the most similar ligand is CHEMBL2205812. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL2205812 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | COc1ccc(CCN2C3C4C5CC6C7C5C3C7C2(O)C46)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000000 01000008 20100108 00010600 00181000 00008010 02040000 20000000 00400280 000808c0 08200000 40018000 00000002 00800010 01000001 00180008 00000000 02000000 02402000 80020201 00000000 18200050 01000000 81500010 00000000 80000000 00120000 10001000 04000200 01060002 80020000 00002e00 |