On Target EDNRA_HUMAN 0.13580246/CHEMBL286808
For the given ligand ZJH-P, we have found in our database that, being scored 0.13580246, the most similar ligand is CHEMBL286808. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL286808 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC(=O)[C@@H]1[C@@H]([C@H]2[C@@H]1c3ccccc3C(=O)c4ccccc24)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00050000 01000800 00000102 00010200 00280000 00008002 01001400 01000001 04000800 00080840 08100000 40009000 04008008 00a00010 00000020 00080008 00000000 02000000 00502008 00000001 00400100 08120a40 01404040 00400814 00000800 a0000001 00000000 40000000 02000082 00020002 80000000 00400500 |