On Target CCR2_HUMAN 0.35135135/CHEMBL1829622
For the given ligand D9-1, we have found in our database that, being scored 0.35135135, the most similar ligand is CHEMBL1829622. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL1829622 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | FC(F)(F)c1cccc(c1)C(=O)NCC(=O)NC2CN(C2)[C@@H]3CC[C@H](CC3)c4cnccn4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000800a 01022800 00100502 14810610 00000141 00000000 1100a400 22001008 10500800 000908d0 00208000 4001a002 02008802 01002800 00820401 0804000c 08000000 06000000 02002408 00000201 00300000 38028610 21000003 0250001c 00040000 c0000000 08000000 90000084 08000106 00860803 a0164000 20002200 |