On Target 5HT7R_HUMAN 0.29104477/CHEMBL3959209
For the given ligand D9-1, we have found in our database that, being scored 0.29104477, the most similar ligand is CHEMBL3959209. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL3959209 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | Cl.Cl.C(CN1CCc2ccccc2C1)Cc3nc4ccccc4[nH]3 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000000a 00000000 00100500 10010600 00040060 00004000 00000020 22001000 00000180 000808c0 09208004 40808000 00000882 00600000 00020440 020c0004 00000200 06000020 00200008 00000201 60020000 18208020 21804000 81400010 00000000 c0000000 00004000 90000100 04000104 00c60802 60040000 20022680 |