On Target OPRD_HUMAN 0.5/CHEMBL437372
For the given ligand D9-1, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL437372. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL437372 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC1=C(C)N=C(CCCNC(=O)[C@@H](N)Cc2c(C)cc(O)cc2C)C(=O)N1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000002a 40003208 20100500 10810610 00000263 00000000 1300a824 20000008 16400800 000808f0 08308000 4000b000 04008082 00200800 00820000 0204000c 08008000 06000000 00000408 00020201 24020180 38048600 21004001 83600418 00040800 c0000001 08120000 10001104 0c000004 0886080b 00000080 20002600 |