On Target TSHR_HUMAN 0.20833333/CHEMBL3983689
For the given ligand D9-1, we have found in our database that, being scored 0.20833333, the most similar ligand is CHEMBL3983689. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL3983689 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC(=O)N1c2ccc(NC(=O)c3ccccn3)cc2C(C)(CC1(C)C)c4ccccc4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 08004002 01201a00 40104102 10010e00 24060020 00182040 01000000 23001001 00400800 000808d0 08390024 4000c000 00008802 00300800 00020040 02040104 00048000 02000001 08200008 00000201 44100100 18068600 20812000 0040001c 00140000 a1000001 00000050 d0001080 00488184 0006000b 80040080 20004600 |