On Target CCR1_HUMAN 0.26086956/CHEMBL358283
For the given ligand D9-1, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL358283. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL358283 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | OC1(CCN(CCCC(C#N)(c2ccccc2)c3ccccc3)CC1)c4ccccn4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000000a 01000200 00104102 10010600 00040020 00004000 00000020 21000000 00100b00 000808c0 08308004 50818000 00000802 00200000 00020000 020c000c 00408000 06800000 00a00008 00000201 60000100 38008020 21800482 00500010 00000001 a0000000 00000040 50000100 00000084 0086000a 40000000 20002680 |