On Target GRM1_HUMAN 0.32407406/CHEMBL254372
For the given ligand Ginkgo C, we have found in our database that, being scored 0.32407406, the most similar ligand is CHEMBL254372. Check out the elaboration below.
| Ginkgo C (Given Ligand) | CHEMBL254372 (Similar Ligand) |
|---|---|
| [H][C@]12OC(=O)[C@H](O)C15C[C@@H](O)[C@@]4([H])OC(=O)C6(O2)[C@@]3(O)[C@H](C)C(=O)O[C@@]3([H])[C@H](O)C456 | C=C1C[C@@H]2COC(=O)[C@]2(Cc3ccc4ccccc4c3)C1 |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 082a9008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00050040 81000008 00000102 80010300 00080000 00000000 00000000 00000400 00000800 00188848 08100000 40009000 04008008 00a00000 00080400 00081008 00820000 02000000 00402008 00000001 00000120 08000a08 01000040 00400010 00000c00 80002000 00000000 80000000 00000202 81020002 24020000 00000400 |