On Target CXCR2_HUMAN 0.17763157/CHEMBL3645131
For the given ligand Biloblide D, we have found in our database that, being scored 0.17763157, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |