On Target DRD5_HUMAN 0.14893617/CHEMBL1258223
For the given ligand Biloblide D, we have found in our database that, being scored 0.14893617, the most similar ligand is CHEMBL1258223. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL1258223 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CCCCN1CCC(COC(=O)c2cc(Cl)c(NC)c3OCCOc23)CC1 |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 04008002 d9000808 20100108 80290700 80101010 04024000 96000200 28000800 00002130 000008c8 00240004 50018820 0280c006 08018082 81204047 2208f008 00060800 02008400 08480002 00022601 40000020 38020b20 25400000 08500014 00002400 80002400 20180a00 10800080 00808300 0006080a c0004000 02022a00 |