On Target TAAR1_HUMAN 0.26797387/CHEMBL1420390
For the given ligand Biloblide D, we have found in our database that, being scored 0.26797387, the most similar ligand is CHEMBL1420390. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL1420390 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | OC(=O)C1C2OC(C=C2)C1C(=O)NCCc3cccc(Cl)c3 |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 00078040 85001000 00100100 00010700 003c0040 00200000 06000000 28000406 10000080 011888c8 08200000 40019800 16028006 00080000 80080400 00081008 00204010 02000120 11c12010 02002201 00000020 18200f00 01008080 81580018 00203401 80000400 00404200 90000000 04000202 80060003 04000000 00822e10 |