On Target ADA2A_HUMAN 0.47619048/CHEMBL513389
For the given ligand THC, we have found in our database that, being scored 0.47619048, the most similar ligand is CHEMBL513389. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL513389 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CC(C)NC(C)C(O)COc1ccc(C)c2CCCc12 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000000 43000008 2010010a 00010700 00001081 c2000000 02040000 00000200 00000810 00080840 08300000 40008040 00800002 20201080 11200021 000a2008 10200000 22008000 00c80000 00020201 00000100 18000000 07004080 08400410 00000001 c0000001 00020000 00800000 00000300 00064002 00000000 00000640 |