On Target NPFF1_HUMAN 0.019607844/CHEMBL573297
For the given ligand CC, we have found in our database that, being scored 0.019607844, the most similar ligand is CHEMBL573297. Check out the elaboration below.
| CC (Given Ligand) | CHEMBL573297 (Similar Ligand) |
|---|---|
| CC | NC(=N)N\N=C\c1ccc(Br)c(Br)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004008 00008000 00000100 00010a00 00002000 00000000 00000000 81084000 40000100 00000843 00000000 c0008000 80000010 08000000 00800000 00080000 00000000 02000000 00000400 00000000 00080000 88000000 40040000 00400000 00000000 80000800 40120100 00000000 00000028 000e1000 40100808 08000000 |